Products 1017777-41-1
CAS 1017777-41-1 appears in our catalog under these names: 2-Fluoro-4,6-bis(trifluoromethyl)benzoic acid, 95%, 2-Fluoro-4,6-bis(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
2-fluoro-4,6-bis(trifluoromethyl)benzoic acid (CAS 1017777-41-1) is a chemical compound with the molecular formula C9H3F7O2 and a molecular weight of 276.11 g/mol. IUPAC name: 2-fluoro-4,6-bis(trifluoromethyl)benzoic acid. InChIKey: MRBORTVPNDQHFN-UHFFFAOYSA-N.
| Molecular formula | C9H3F7O2 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | 2-fluoro-4,6-bis(trifluoromethyl)benzoic acid |
| InChIKey | MRBORTVPNDQHFN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)C(=O)O)F)C(F)(F)F |
Computed by PubChem (NCBI)