Products 101778-85-2

CAS 101778-85-2 is the registry number for Benzyl 11-aminoundecanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 11-aminoundecanoate;hydrochloride (CAS 101778-85-2) is a chemical compound with the molecular formula C18H30ClNO2 and a molecular weight of 327.9 g/mol. IUPAC name: benzyl 11-aminoundecanoate;hydrochloride. InChIKey: BQFDVFPORANMDK-UHFFFAOYSA-N.

Identity
Molecular formulaC18H30ClNO2
Molecular weight327.9 g/mol
IUPAC namebenzyl 11-aminoundecanoate;hydrochloride
InChIKeyBQFDVFPORANMDK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)CCCCCCCCCCN.Cl

Computed by PubChem (NCBI)