Products 1017781-51-9
CAS 1017781-51-9 is the registry number for 4-(3-(3-Chloro-phenyl)-3-oxo-propionyl)-piperidine-1-carboxylic acid tert-butyl ester. Offered by: Biosynth. Available pack sizes: 0,05g.
Tert-butyl 4-[3-(3-chlorophenyl)-3-oxopropanoyl]piperidine-1-carboxylate (CAS 1017781-51-9) is a chemical compound with the molecular formula C19H24ClNO4 and a molecular weight of 365.8 g/mol. IUPAC name: tert-butyl 4-[3-(3-chlorophenyl)-3-oxopropanoyl]piperidine-1-carboxylate. InChIKey: RWBJYKWNIJGNAI-UHFFFAOYSA-N.
| Molecular formula | C19H24ClNO4 |
|---|---|
| Molecular weight | 365.8 g/mol |
| IUPAC name | tert-butyl 4-[3-(3-chlorophenyl)-3-oxopropanoyl]piperidine-1-carboxylate |
| InChIKey | RWBJYKWNIJGNAI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)CC(=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)