CAS 1017791-37-5 appears in our catalog under these names: 4-Acetyl-3,4-dihydro-2h-1,4-benzoxazine-6-sulfonyl chloride, 95%, 4-Acetyl-3,4-dihydro-2H-benzo(b)(1,4)oxazine-6-sulfonyl chloride, 95%, 4–Acetyl–3,4–dihydro–2H–benzo(b)(1,4)oxazine–6–sulfonyl chloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride (CAS 1017791-37-5) is a chemical compound with the molecular formula C10H10ClNO4S and a molecular weight of 275.71 g/mol. IUPAC name: 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride. InChIKey: ABMZXQIJEDEIAB-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO4S |
|---|---|
| Molecular weight | 275.71 g/mol |
| IUPAC name | 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride |
| InChIKey | ABMZXQIJEDEIAB-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCOC2=C1C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)