CAS 1017878-67-9 appears in our catalog under these names: Nebivolol Impurity 102, 2-Chloro-1-(6-fluorochroman-2-yl)ethan-1-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanol (CAS 1017878-67-9) is a chemical compound with the molecular formula C11H12ClFO2 and a molecular weight of 230.66 g/mol. IUPAC name: 2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanol. InChIKey: CJWPZPOGTNMOCI-UHFFFAOYSA-N.
| Molecular formula | C11H12ClFO2 |
|---|---|
| Molecular weight | 230.66 g/mol |
| IUPAC name | 2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanol |
| InChIKey | CJWPZPOGTNMOCI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)OC1C(CCl)O |
Computed by PubChem (NCBI)