Products 1017931-53-1
CAS 1017931-53-1 appears in our catalog under these names: Cathepsin Inhibitor 2, 99.77%, Cathepsin Inhibitor 2, 98.05%. Offered by: MedChemExpress, Chemat. Available pack sizes: 1 mg, 10 mg, 5 mg, 10mM/1mL, 25 mg, 1mg, 5mg.
(2S)-N-(1-cyanocyclopropyl)-4,4-difluoro-2-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]heptanamide (CAS 1017931-53-1) is a chemical compound with the molecular formula C19H21F6N3O and a molecular weight of 421.4 g/mol. IUPAC name: (2S)-N-(1-cyanocyclopropyl)-4,4-difluoro-2-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]heptanamide. InChIKey: SPJXTKFUGDUWFY-GJZGRUSLSA-N.
| Molecular formula | C19H21F6N3O |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | (2S)-N-(1-cyanocyclopropyl)-4,4-difluoro-2-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]heptanamide |
| InChIKey | SPJXTKFUGDUWFY-GJZGRUSLSA-N |
| SMILES | CCCC(C[C@@H](C(=O)NC1(CC1)C#N)N[C@@H](C2=CC=C(C=C2)F)C(F)(F)F)(F)F |
Computed by PubChem (NCBI)