CAS 1018047-90-9 appears in our catalog under these names: 3-Phenyl-4-(trifluoromethyl)isoxazolo(5,4-b)pyridin-6(7H)-one, 97%, 3-Phenyl-4-(trifluoromethyl)isoxazolo(5,4-b)pyridin-6(7H)-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-phenyl-4-(trifluoromethyl)-7H-[1,2]oxazolo[5,4-b]pyridin-6-one (CAS 1018047-90-9) is a chemical compound with the molecular formula C13H7F3N2O2 and a molecular weight of 280.20 g/mol. IUPAC name: 3-phenyl-4-(trifluoromethyl)-7H-[1,2]oxazolo[5,4-b]pyridin-6-one. InChIKey: CQGYWRSGVYZHTB-UHFFFAOYSA-N.
| Molecular formula | C13H7F3N2O2 |
|---|---|
| Molecular weight | 280.20 g/mol |
| IUPAC name | 3-phenyl-4-(trifluoromethyl)-7H-[1,2]oxazolo[5,4-b]pyridin-6-one |
| InChIKey | CQGYWRSGVYZHTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC3=C2C(=CC(=O)N3)C(F)(F)F |
Computed by PubChem (NCBI)