CAS 1018143-24-2 is the registry number for 5-(4-Fluorophenyl)-(1,2,4)triazolo(1,5-a)pyrimidine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylic acid (CAS 1018143-24-2) is a chemical compound with the molecular formula C12H7FN4O2 and a molecular weight of 258.21 g/mol. IUPAC name: 5-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylic acid. InChIKey: GMLJATHLEWYGQT-UHFFFAOYSA-N.
| Molecular formula | C12H7FN4O2 |
|---|---|
| Molecular weight | 258.21 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxylic acid |
| InChIKey | GMLJATHLEWYGQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=NC=NN3C(=C2)C(=O)O)F |
Computed by PubChem (NCBI)