CAS 1018150-76-9 is the registry number for 2-(4-(Difluoromethyl)-3-methyl-6-oxo-1H,6H,7H-pyrazolo(3,4-b)pyridin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-[4-(difluoromethyl)-3-methyl-6-oxo-7H-pyrazolo[5,4-b]pyridin-1-yl]acetic acid (CAS 1018150-76-9) is a chemical compound with the molecular formula C10H9F2N3O3 and a molecular weight of 257.19 g/mol. IUPAC name: 2-[4-(difluoromethyl)-3-methyl-6-oxo-7H-pyrazolo[5,4-b]pyridin-1-yl]acetic acid. InChIKey: WULKBPXKWCRBCZ-UHFFFAOYSA-N.
| Molecular formula | C10H9F2N3O3 |
|---|---|
| Molecular weight | 257.19 g/mol |
| IUPAC name | 2-[4-(difluoromethyl)-3-methyl-6-oxo-7H-pyrazolo[5,4-b]pyridin-1-yl]acetic acid |
| InChIKey | WULKBPXKWCRBCZ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=O)N2)C(F)F)CC(=O)O |
Computed by PubChem (NCBI)