CAS 1018165-34-8 is the registry number for 3-(4-(Difluoromethyl)-2-methyl-6-oxo-2H,6H,7H-pyrazolo(3,4-b)pyridin-7-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-[4-(difluoromethyl)-2-methyl-6-oxopyrazolo[3,4-b]pyridin-7-yl]propanoic acid (CAS 1018165-34-8) is a chemical compound with the molecular formula C11H11F2N3O3 and a molecular weight of 271.22 g/mol. IUPAC name: 3-[4-(difluoromethyl)-2-methyl-6-oxopyrazolo[3,4-b]pyridin-7-yl]propanoic acid. InChIKey: ZRCVVQNURQMNJS-UHFFFAOYSA-N.
| Molecular formula | C11H11F2N3O3 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | 3-[4-(difluoromethyl)-2-methyl-6-oxopyrazolo[3,4-b]pyridin-7-yl]propanoic acid |
| InChIKey | ZRCVVQNURQMNJS-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=CC(=O)N(C2=N1)CCC(=O)O)C(F)F |
Computed by PubChem (NCBI)