Products 101846-86-0
CAS 101846-86-0 appears in our catalog under these names: Butenafine Impurity 10, Butenafine Impurity 7, Butenafine Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[(4-tert-butylphenyl)methyl]-N-methylnaphthalene-1-carboxamide (CAS 101846-86-0) is a chemical compound with the molecular formula C23H25NO and a molecular weight of 331.4 g/mol. IUPAC name: N-[(4-tert-butylphenyl)methyl]-N-methylnaphthalene-1-carboxamide. InChIKey: VJKUIHGLHKFWFY-UHFFFAOYSA-N.
| Molecular formula | C23H25NO |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | N-[(4-tert-butylphenyl)methyl]-N-methylnaphthalene-1-carboxamide |
| InChIKey | VJKUIHGLHKFWFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CN(C)C(=O)C2=CC=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)