Products 1018480-89-1
CAS 1018480-89-1 is the registry number for COX-2-IN-39. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-methoxy-2-(4-methylsulfonylphenyl)-N-(thiophen-2-ylmethyl)pyrimidin-4-amine (CAS 1018480-89-1) is a chemical compound with the molecular formula C17H17N3O3S2 and a molecular weight of 375.5 g/mol. IUPAC name: 6-methoxy-2-(4-methylsulfonylphenyl)-N-(thiophen-2-ylmethyl)pyrimidin-4-amine. InChIKey: LWZBBNWYOITRHC-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O3S2 |
|---|---|
| Molecular weight | 375.5 g/mol |
| IUPAC name | 6-methoxy-2-(4-methylsulfonylphenyl)-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
| InChIKey | LWZBBNWYOITRHC-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC(=C1)NCC2=CC=CS2)C3=CC=C(C=C3)S(=O)(=O)C |
Computed by PubChem (NCBI)