CAS 1018656-49-9 is the registry number for 2-(1,1-Dioxidotetrahydro-3-thienyl)ethanesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.
2-(1,1-dioxothiolan-3-yl)ethanesulfonyl chloride (CAS 1018656-49-9) is a chemical compound with the molecular formula C6H11ClO4S2 and a molecular weight of 246.7 g/mol. IUPAC name: 2-(1,1-dioxothiolan-3-yl)ethanesulfonyl chloride. InChIKey: RZKLKQRKAJQACM-UHFFFAOYSA-N.
| Molecular formula | C6H11ClO4S2 |
|---|---|
| Molecular weight | 246.7 g/mol |
| IUPAC name | 2-(1,1-dioxothiolan-3-yl)ethanesulfonyl chloride |
| InChIKey | RZKLKQRKAJQACM-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1CCS(=O)(=O)Cl |
Computed by PubChem (NCBI)