Products 1018656-49-9

CAS 1018656-49-9 is the registry number for 2-(1,1-Dioxidotetrahydro-3-thienyl)ethanesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-(1,1-dioxothiolan-3-yl)ethanesulfonyl chloride (CAS 1018656-49-9) is a chemical compound with the molecular formula C6H11ClO4S2 and a molecular weight of 246.7 g/mol. IUPAC name: 2-(1,1-dioxothiolan-3-yl)ethanesulfonyl chloride. InChIKey: RZKLKQRKAJQACM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClO4S2
Molecular weight246.7 g/mol
IUPAC name2-(1,1-dioxothiolan-3-yl)ethanesulfonyl chloride
InChIKeyRZKLKQRKAJQACM-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1CCS(=O)(=O)Cl

Computed by PubChem (NCBI)