Products 101892-34-6
CAS 101892-34-6 is the registry number for tetramethyl adamantane-1,3,5,7-tetracarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tetramethyl adamantane-1,3,5,7-tetracarboxylate (CAS 101892-34-6) is a chemical compound with the molecular formula C18H24O8 and a molecular weight of 368.4 g/mol. IUPAC name: tetramethyl adamantane-1,3,5,7-tetracarboxylate. InChIKey: CBGOLMWJUCAGRW-UHFFFAOYSA-N.
| Molecular formula | C18H24O8 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | tetramethyl adamantane-1,3,5,7-tetracarboxylate |
| InChIKey | CBGOLMWJUCAGRW-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3(CC(C1)(CC(C2)(C3)C(=O)OC)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)