CAS 1018978-86-3 is the registry number for (4R)-6-Chlorochromane-4-ylamine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g, 25g.
(4R)-6-chloro-3,4-dihydro-2H-chromen-4-amine (CAS 1018978-86-3) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: (4R)-6-chloro-3,4-dihydro-2H-chromen-4-amine. InChIKey: DLMNYSHJWHCTOD-MRVPVSSYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | (4R)-6-chloro-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | DLMNYSHJWHCTOD-MRVPVSSYSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=C(C=C2)Cl |
Computed by PubChem (NCBI)