CAS 101901-50-2 is the registry number for 3,5-Dimethyladamantane-1-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3,5-dimethyladamantane-1-carbonitrile (CAS 101901-50-2) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: 3,5-dimethyladamantane-1-carbonitrile. InChIKey: OEXPKZUHIXLJBX-UHFFFAOYSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | 3,5-dimethyladamantane-1-carbonitrile |
| InChIKey | OEXPKZUHIXLJBX-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)C#N)C |
Computed by PubChem (NCBI)