CAS 1019015-56-5 is the registry number for 1-tert-Butyl-3-(4-fluorophenyl)-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-tert-butyl-3-(4-fluorophenyl)pyrazol-5-amine (CAS 1019015-56-5) is a chemical compound with the molecular formula C13H16FN3 and a molecular weight of 233.28 g/mol. IUPAC name: 1-tert-butyl-3-(4-fluorophenyl)pyrazol-5-amine. InChIKey: VARQUJWBLJWLFV-UHFFFAOYSA-N.
| Molecular formula | C13H16FN3 |
|---|---|
| Molecular weight | 233.28 g/mol |
| IUPAC name | 1-tert-butyl-3-(4-fluorophenyl)pyrazol-5-amine |
| InChIKey | VARQUJWBLJWLFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=CC(=N1)C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)