Products 101911-70-0

CAS 101911-70-0 is the registry number for m-Hydroxyphenyl Glycerol m-O-Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

[3-(1,2-dihydroxyethyl)phenyl] hydrogen sulfate (CAS 101911-70-0) is a chemical compound with the molecular formula C8H10O6S and a molecular weight of 234.23 g/mol. IUPAC name: [3-(1,2-dihydroxyethyl)phenyl] hydrogen sulfate. InChIKey: YKWHNNQDBSJJKG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O6S
Molecular weight234.23 g/mol
IUPAC name[3-(1,2-dihydroxyethyl)phenyl] hydrogen sulfate
InChIKeyYKWHNNQDBSJJKG-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OS(=O)(=O)O)C(CO)O

Computed by PubChem (NCBI)