CAS 101911-70-0 is the registry number for m-Hydroxyphenyl Glycerol m-O-Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.
[3-(1,2-dihydroxyethyl)phenyl] hydrogen sulfate (CAS 101911-70-0) is a chemical compound with the molecular formula C8H10O6S and a molecular weight of 234.23 g/mol. IUPAC name: [3-(1,2-dihydroxyethyl)phenyl] hydrogen sulfate. InChIKey: YKWHNNQDBSJJKG-UHFFFAOYSA-N.
| Molecular formula | C8H10O6S |
|---|---|
| Molecular weight | 234.23 g/mol |
| IUPAC name | [3-(1,2-dihydroxyethyl)phenyl] hydrogen sulfate |
| InChIKey | YKWHNNQDBSJJKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OS(=O)(=O)O)C(CO)O |
Computed by PubChem (NCBI)