CAS 1019115-44-6 is the registry number for 2-Bromo-4,7-dimethylbenzo[d]thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4,7-dimethyl-1,3-benzothiazole (CAS 1019115-44-6) is a chemical compound with the molecular formula C9H8BrNS and a molecular weight of 242.14 g/mol. IUPAC name: 2-bromo-4,7-dimethyl-1,3-benzothiazole. InChIKey: OMCQXYRXLFOIDF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNS |
|---|---|
| Molecular weight | 242.14 g/mol |
| IUPAC name | 2-bromo-4,7-dimethyl-1,3-benzothiazole |
| InChIKey | OMCQXYRXLFOIDF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)C)SC(=N2)Br |
Computed by PubChem (NCBI)