CAS 1019153-09-3 is the registry number for 3-((3,5-Dichlorophenyl)sulfonyl)-6-isocyanoquinolin-4(1H)-one. Offered by: TRC. Available pack sizes: 100mg.
3-(3,5-dichlorophenyl)sulfonyl-4-oxo-1H-quinoline-6-carbonitrile (CAS 1019153-09-3) is a chemical compound with the molecular formula C16H8Cl2N2O3S and a molecular weight of 379.2 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)sulfonyl-4-oxo-1H-quinoline-6-carbonitrile. InChIKey: IXEQXQYNYFKQFR-UHFFFAOYSA-N.
| Molecular formula | C16H8Cl2N2O3S |
|---|---|
| Molecular weight | 379.2 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)sulfonyl-4-oxo-1H-quinoline-6-carbonitrile |
| InChIKey | IXEQXQYNYFKQFR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=O)C(=CN2)S(=O)(=O)C3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)