CAS 101932-75-6 appears in our catalog under these names: Bis(tetramethylcyclopentadienyl)manganese, 95%, BIS(TETRAMETHYLCYCLOPENTADIENYL)MANGANESE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
Manganese(2+);bis(1,2,3,5-tetramethylcyclopenta-1,3-diene) (CAS 101932-75-6) is a chemical compound with the molecular formula C18H26Mn and a molecular weight of 297.3 g/mol. IUPAC name: manganese(2+);bis(1,2,3,5-tetramethylcyclopenta-1,3-diene). InChIKey: FUUKHNRDHFIZLM-UHFFFAOYSA-N.
| Molecular formula | C18H26Mn |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | manganese(2+);bis(1,2,3,5-tetramethylcyclopenta-1,3-diene) |
| InChIKey | FUUKHNRDHFIZLM-UHFFFAOYSA-N |
| SMILES | CC1[C-]=C(C(=C1C)C)C.CC1[C-]=C(C(=C1C)C)C.[Mn+2] |
Computed by PubChem (NCBI)