Products 101937-44-4

CAS 101937-44-4 is the registry number for Diethyl 2–((4–bromophenylamino)methylene)malonate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Diethyl 2-[(4-bromoanilino)methylidene]propanedioate (CAS 101937-44-4) is a chemical compound with the molecular formula C14H16BrNO4 and a molecular weight of 342.18 g/mol. IUPAC name: diethyl 2-[(4-bromoanilino)methylidene]propanedioate. InChIKey: CZRWKFPNRGCSND-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16BrNO4
Molecular weight342.18 g/mol
IUPAC namediethyl 2-[(4-bromoanilino)methylidene]propanedioate
InChIKeyCZRWKFPNRGCSND-UHFFFAOYSA-N
SMILESCCOC(=O)C(=CNC1=CC=C(C=C1)Br)C(=O)OCC

Computed by PubChem (NCBI)