CAS 1019382-22-9 appears in our catalog under these names: 2-Chloro-N-(2,2-difluoro-2H-1,3-benzodioxol-5-yl)propanamide, 95%, 2-Chloro-N-(2,2-difluoro-1,3-dioxaindan-5-yl)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)propanamide (CAS 1019382-22-9) is a chemical compound with the molecular formula C10H8ClF2NO3 and a molecular weight of 263.62 g/mol. IUPAC name: 2-chloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)propanamide. InChIKey: HEJRVSZXCMJVSZ-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF2NO3 |
|---|---|
| Molecular weight | 263.62 g/mol |
| IUPAC name | 2-chloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)propanamide |
| InChIKey | HEJRVSZXCMJVSZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC2=C(C=C1)OC(O2)(F)F)Cl |
Computed by PubChem (NCBI)