CAS 1019384-02-1 is the registry number for 4-Chloro-2-cyclopropyl-5-phenylthieno(2,3-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-2-cyclopropyl-5-phenylthieno[2,3-d]pyrimidine (CAS 1019384-02-1) is a chemical compound with the molecular formula C15H11ClN2S and a molecular weight of 286.8 g/mol. IUPAC name: 4-chloro-2-cyclopropyl-5-phenylthieno[2,3-d]pyrimidine. InChIKey: GDFQJKDEJAHULN-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2S |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | 4-chloro-2-cyclopropyl-5-phenylthieno[2,3-d]pyrimidine |
| InChIKey | GDFQJKDEJAHULN-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(C(=CS3)C4=CC=CC=C4)C(=N2)Cl |
Computed by PubChem (NCBI)