Products 1019441-79-2
CAS 1019441-79-2 is the registry number for 2-(4-Bromophenoxy)-3-(trifluoromethyl)pyridine. Offered by: Biosynth. Available pack sizes: 1g, 10g.
2-(4-bromophenoxy)-3-(trifluoromethyl)pyridine (CAS 1019441-79-2) is a chemical compound with the molecular formula C12H7BrF3NO and a molecular weight of 318.09 g/mol. IUPAC name: 2-(4-bromophenoxy)-3-(trifluoromethyl)pyridine. InChIKey: OLGCYDJEZGMFQF-UHFFFAOYSA-N.
| Molecular formula | C12H7BrF3NO |
|---|---|
| Molecular weight | 318.09 g/mol |
| IUPAC name | 2-(4-bromophenoxy)-3-(trifluoromethyl)pyridine |
| InChIKey | OLGCYDJEZGMFQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC2=CC=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)