CAS 1019535-31-9 appears in our catalog under these names: 4-((4-Methyl-1,3-thiazol-2-yl)amino)benzene-1-carbothioamide, 95%, 4-((4-Methyl-1,3-thiazol-2-yl)amino)benzene-1-carbothioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-[(4-methyl-1,3-thiazol-2-yl)amino]benzenecarbothioamide (CAS 1019535-31-9) is a chemical compound with the molecular formula C11H11N3S2 and a molecular weight of 249.4 g/mol. IUPAC name: 4-[(4-methyl-1,3-thiazol-2-yl)amino]benzenecarbothioamide. InChIKey: PYUORRNMXOKVKK-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S2 |
|---|---|
| Molecular weight | 249.4 g/mol |
| IUPAC name | 4-[(4-methyl-1,3-thiazol-2-yl)amino]benzenecarbothioamide |
| InChIKey | PYUORRNMXOKVKK-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)NC2=CC=C(C=C2)C(=S)N |
Computed by PubChem (NCBI)