CAS 1019580-89-2 is the registry number for 1-((4-Chlorophenyl)methyl)-1,2,3,4-tetrahydroquinolin-6-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-amine (CAS 1019580-89-2) is a chemical compound with the molecular formula C16H17ClN2 and a molecular weight of 272.77 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-amine. InChIKey: GCEZBESOBSHFHY-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2 |
|---|---|
| Molecular weight | 272.77 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-3,4-dihydro-2H-quinolin-6-amine |
| InChIKey | GCEZBESOBSHFHY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)N)N(C1)CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)