CAS 1019603-18-9 is the registry number for 1-[3-Fluoro-4-(propan-2-yloxy)phenyl]ethan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-fluoro-4-propan-2-yloxyphenyl)ethanamine (CAS 1019603-18-9) is a chemical compound with the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. IUPAC name: 1-(3-fluoro-4-propan-2-yloxyphenyl)ethanamine. InChIKey: VCPUTTXYTNLILD-UHFFFAOYSA-N.
| Molecular formula | C11H16FNO |
|---|---|
| Molecular weight | 197.25 g/mol |
| IUPAC name | 1-(3-fluoro-4-propan-2-yloxyphenyl)ethanamine |
| InChIKey | VCPUTTXYTNLILD-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C(C)N)F |
Computed by PubChem (NCBI)