CAS 1019614-22-2 appears in our catalog under these names: 2,4-Difluoro-N-(pyridin-2-ylmethyl)aniline, 2,4-Difluoro-n-(pyridin-2-ylmethyl)aniline, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
2,4-difluoro-N-(pyridin-2-ylmethyl)aniline (CAS 1019614-22-2) is a chemical compound with the molecular formula C12H10F2N2 and a molecular weight of 220.22 g/mol. IUPAC name: 2,4-difluoro-N-(pyridin-2-ylmethyl)aniline. InChIKey: WNIFZTLYRMLXLG-UHFFFAOYSA-N.
| Molecular formula | C12H10F2N2 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2,4-difluoro-N-(pyridin-2-ylmethyl)aniline |
| InChIKey | WNIFZTLYRMLXLG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)