Products 101980-37-4
CAS 101980-37-4 is the registry number for 2-Methyl-3-furoic Acid-d3. Offered by: TRC. Available pack sizes: 25mg.
2-(trideuteriomethyl)furan-3-carboxylic acid (CAS 101980-37-4) is a chemical compound with the molecular formula C6H6O3 and a molecular weight of 129.13 g/mol. IUPAC name: 2-(trideuteriomethyl)furan-3-carboxylic acid. InChIKey: CFGQZVOVFIZRMN-FIBGUPNXSA-N.
| Molecular formula | C6H6O3 |
|---|---|
| Molecular weight | 129.13 g/mol |
| IUPAC name | 2-(trideuteriomethyl)furan-3-carboxylic acid |
| InChIKey | CFGQZVOVFIZRMN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CO1)C(=O)O |
Computed by PubChem (NCBI)