CAS 10199-34-5 is the registry number for Bis(triphenylphosphine)platinum dichloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dichloroplatinum;bis(triphenylphosphane) (CAS 10199-34-5) is a chemical compound with the molecular formula C36H30Cl2P2Pt and a molecular weight of 790.6 g/mol. IUPAC name: dichloroplatinum;bis(triphenylphosphane). InChIKey: XAFJSPPHVXDRIE-UHFFFAOYSA-L.
| Molecular formula | C36H30Cl2P2Pt |
|---|---|
| Molecular weight | 790.6 g/mol |
| IUPAC name | dichloroplatinum;bis(triphenylphosphane) |
| InChIKey | XAFJSPPHVXDRIE-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Pt]Cl |
Computed by PubChem (NCBI)