CAS 1020169-24-7 is the registry number for Methyl (S)-2-(4-((3,4-dichlorobenzyl)oxy)phenyl)-2-hydroxyacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-hydroxyacetate (CAS 1020169-24-7) is a chemical compound with the molecular formula C16H14Cl2O4 and a molecular weight of 341.2 g/mol. IUPAC name: methyl 2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-hydroxyacetate. InChIKey: LTCNMAXNNIYTLU-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2O4 |
|---|---|
| Molecular weight | 341.2 g/mol |
| IUPAC name | methyl 2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-2-hydroxyacetate |
| InChIKey | LTCNMAXNNIYTLU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)OCC2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)