CAS 1020251-86-8 is the registry number for 3-(tert-butyl)-1-(4-nitrophenyl)indeno(2,3-d)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
3-tert-butyl-1-(4-nitrophenyl)indeno[2,1-d]pyrazol-4-one (CAS 1020251-86-8) is a chemical compound with the molecular formula C20H17N3O3 and a molecular weight of 347.4 g/mol. IUPAC name: 3-tert-butyl-1-(4-nitrophenyl)indeno[2,1-d]pyrazol-4-one. InChIKey: LTTCPQLJVCBFLQ-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 3-tert-butyl-1-(4-nitrophenyl)indeno[2,1-d]pyrazol-4-one |
| InChIKey | LTTCPQLJVCBFLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C2=C1C(=O)C3=CC=CC=C32)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)