CAS 1020252-17-8 is the registry number for 2-(4-chloro-2-methylphenoxy)-6-fluorobenzenecarbonitrile. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.
2-(4-chloro-2-methylphenoxy)-6-fluorobenzonitrile (CAS 1020252-17-8) is a chemical compound with the molecular formula C14H9ClFNO and a molecular weight of 261.68 g/mol. IUPAC name: 2-(4-chloro-2-methylphenoxy)-6-fluorobenzonitrile. InChIKey: GKULZZNWGYNUSD-UHFFFAOYSA-N.
| Molecular formula | C14H9ClFNO |
|---|---|
| Molecular weight | 261.68 g/mol |
| IUPAC name | 2-(4-chloro-2-methylphenoxy)-6-fluorobenzonitrile |
| InChIKey | GKULZZNWGYNUSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC2=C(C(=CC=C2)F)C#N |
Computed by PubChem (NCBI)