CAS 1020252-48-5 is the registry number for 2-methyl-1-(4-(isopropyl)phenyl)-2-(1,2,4-triazolyl)propan-1-one. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
2-methyl-1-(4-propan-2-ylphenyl)-2-(1,2,4-triazol-1-yl)propan-1-one (CAS 1020252-48-5) is a chemical compound with the molecular formula C15H19N3O and a molecular weight of 257.33 g/mol. IUPAC name: 2-methyl-1-(4-propan-2-ylphenyl)-2-(1,2,4-triazol-1-yl)propan-1-one. InChIKey: VTTSLYHYTJVHOL-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 2-methyl-1-(4-propan-2-ylphenyl)-2-(1,2,4-triazol-1-yl)propan-1-one |
| InChIKey | VTTSLYHYTJVHOL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)C(C)(C)N2C=NC=N2 |
Computed by PubChem (NCBI)