CAS 1020252-74-7 is the registry number for N-(3,5-Dibromophenyl)pivalamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(3,5-dibromophenyl)-2,2-dimethylpropanamide (CAS 1020252-74-7) is a chemical compound with the molecular formula C11H13Br2NO and a molecular weight of 335.03 g/mol. IUPAC name: N-(3,5-dibromophenyl)-2,2-dimethylpropanamide. InChIKey: FQRDVBBRQWCCSC-UHFFFAOYSA-N.
| Molecular formula | C11H13Br2NO |
|---|---|
| Molecular weight | 335.03 g/mol |
| IUPAC name | N-(3,5-dibromophenyl)-2,2-dimethylpropanamide |
| InChIKey | FQRDVBBRQWCCSC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)