Products 1020252-83-8
CAS 1020252-83-8 is the registry number for N-Butyl 3-bromo-5-(trifluoromethyl)benzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-N-butyl-5-(trifluoromethyl)benzenesulfonamide (CAS 1020252-83-8) is a chemical compound with the molecular formula C11H13BrF3NO2S and a molecular weight of 360.19 g/mol. IUPAC name: 3-bromo-N-butyl-5-(trifluoromethyl)benzenesulfonamide. InChIKey: IJPATHMDDIDFND-UHFFFAOYSA-N.
| Molecular formula | C11H13BrF3NO2S |
|---|---|
| Molecular weight | 360.19 g/mol |
| IUPAC name | 3-bromo-N-butyl-5-(trifluoromethyl)benzenesulfonamide |
| InChIKey | IJPATHMDDIDFND-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=CC(=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)