CAS 1020253-48-8 appears in our catalog under these names: 1-[4-(Difluoromethoxy)phenyl]-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(4-(Difluoromethoxy)phenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
1-[4-(difluoromethoxy)phenyl]-5-methyltriazole-4-carboxylic acid (CAS 1020253-48-8) is a chemical compound with the molecular formula C11H9F2N3O3 and a molecular weight of 269.20 g/mol. IUPAC name: 1-[4-(difluoromethoxy)phenyl]-5-methyltriazole-4-carboxylic acid. InChIKey: GWJAQUCLJNJITA-UHFFFAOYSA-N.
| Molecular formula | C11H9F2N3O3 |
|---|---|
| Molecular weight | 269.20 g/mol |
| IUPAC name | 1-[4-(difluoromethoxy)phenyl]-5-methyltriazole-4-carboxylic acid |
| InChIKey | GWJAQUCLJNJITA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=C(C=C2)OC(F)F)C(=O)O |
Computed by PubChem (NCBI)