CAS 102029-73-2 appears in our catalog under these names: Acetyl Coenzyme A, Sodium salt, ≥ 95%, Acetyl Coenzyme A Trisodium Salt, Acetyl Coenzyme A trisodium/ 95%, Acetyl Coenzyme A (sodium salt), Acetyl coenzyme A sodium salt. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 50mg, 100mg, 1mg, 25mg, 5mg, 10mg, 250mg, 1000mg.
CAS 102029-73-2 identifies a chemical compound with the molecular formula C23H38N7NaO17P3S and a molecular weight of 832.6 g/mol. InChIKey: XGCDESRMLMCTPI-UHFFFAOYSA-N.
| Molecular formula | C23H38N7NaO17P3S |
|---|---|
| Molecular weight | 832.6 g/mol |
| InChIKey | XGCDESRMLMCTPI-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O.[Na] |
Computed by PubChem (NCBI)