CAS 102029-95-8 appears in our catalog under these names: Adenosine 5'-phosphosulfate (sodium salt), Adenosine 5'–phosphosulfate (sodium salt), Adenosine 5′-phosphosulfate sodium salt, Adenosine 5'-phosphosulfate sodium salt, 10 mM in water, ADENOSINE 5'-PHOSPHOSULFATE SODIUM SALT&. Offered by: TargetMol, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 8mg, 4mg, 20mg, 50mg.
CAS 102029-95-8 identifies a chemical compound with the molecular formula C10H14N5NaO10PS and a molecular weight of 450.28 g/mol. InChIKey: KVGKFGUVHSIJFZ-UHFFFAOYSA-N.
| Molecular formula | C10H14N5NaO10PS |
|---|---|
| Molecular weight | 450.28 g/mol |
| InChIKey | KVGKFGUVHSIJFZ-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)OS(=O)(=O)O)O)O)N.[Na] |
Computed by PubChem (NCBI)