CAS 1020399-52-3 is the registry number for Epigenetic multiple ligand, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(3E,5E)-3,5-bis[(3,5-dibromo-4-hydroxyphenyl)methylidene]oxan-4-one (CAS 1020399-52-3) is a chemical compound with the molecular formula C19H12Br4O4 and a molecular weight of 623.9 g/mol. IUPAC name: (3E,5E)-3,5-bis[(3,5-dibromo-4-hydroxyphenyl)methylidene]oxan-4-one. InChIKey: JEDNMNJCJIIYJR-NJDSBKIZSA-N.
| Molecular formula | C19H12Br4O4 |
|---|---|
| Molecular weight | 623.9 g/mol |
| IUPAC name | (3E,5E)-3,5-bis[(3,5-dibromo-4-hydroxyphenyl)methylidene]oxan-4-one |
| InChIKey | JEDNMNJCJIIYJR-NJDSBKIZSA-N |
| SMILES | C\1OC/C(=C\C2=CC(=C(C(=C2)Br)O)Br)/C(=O)/C1=C/C3=CC(=C(C(=C3)Br)O)Br |
Computed by PubChem (NCBI)