CAS 1020414-33-8 appears in our catalog under these names: (R)-N-(1-(7,8-Dihydronaphthalen-1-yl)ethyl)-3-(3-(trifluoromethyl)phenyl)propan-1-amine hydroChloride, 98%, Cinacalcet Impurity 22, Cinacalcet Impurity 6, Cinacalcet Dihydro Impurity 1 HCl, Cinacalcet Impurity 21. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[1-(7,8-dihydronaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 1020414-33-8) is a chemical compound with the molecular formula C22H25ClF3N and a molecular weight of 395.9 g/mol. IUPAC name: N-[1-(7,8-dihydronaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: YTJMTGWNFPWECZ-UHFFFAOYSA-N.
| Molecular formula | C22H25ClF3N |
|---|---|
| Molecular weight | 395.9 g/mol |
| IUPAC name | N-[1-(7,8-dihydronaphthalen-1-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | YTJMTGWNFPWECZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC2=C1CCC=C2)NCCCC3=CC(=CC=C3)C(F)(F)F.Cl |
Computed by PubChem (NCBI)