CAS 1020569-65-6 is the registry number for Ethyl 5-cyclopropyl-3-(2,6-dichlorophenyl)isoxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate (CAS 1020569-65-6) is a chemical compound with the molecular formula C15H13Cl2NO3 and a molecular weight of 326.2 g/mol. IUPAC name: ethyl 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate. InChIKey: LCBWCDNDUBMBBY-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO3 |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | ethyl 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate |
| InChIKey | LCBWCDNDUBMBBY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(ON=C1C2=C(C=CC=C2Cl)Cl)C3CC3 |
Computed by PubChem (NCBI)