CAS 102065-90-7 is the registry number for 1-(Diphenylmethyl)azetidin-3-amine dihydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 25mg, 10mg.
1-benzhydrylazetidin-3-amine;dihydrochloride (CAS 102065-90-7) is a chemical compound with the molecular formula C16H20Cl2N2 and a molecular weight of 311.2 g/mol. IUPAC name: 1-benzhydrylazetidin-3-amine;dihydrochloride. InChIKey: QUKSFTRHZVIHCH-UHFFFAOYSA-N.
| Molecular formula | C16H20Cl2N2 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 1-benzhydrylazetidin-3-amine;dihydrochloride |
| InChIKey | QUKSFTRHZVIHCH-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)N.Cl.Cl |
Computed by PubChem (NCBI)