Products 1020654-44-7
CAS 1020654-44-7 appears in our catalog under these names: 2,4-Dimethylaniline-d9, >95% (GC), 2,4-Xylidine-d9, 99.52%. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 5 mg, 25 mg, 10 mg, 100 mg, 50 mg.
2,3,5-trideuterio-4,6-bis(trideuteriomethyl)aniline (CAS 1020654-44-7) is a chemical compound with the molecular formula C8H11N and a molecular weight of 130.23 g/mol. IUPAC name: 2,3,5-trideuterio-4,6-bis(trideuteriomethyl)aniline. InChIKey: CZZZABOKJQXEBO-XVGWXEQOSA-N.
| Molecular formula | C8H11N |
|---|---|
| Molecular weight | 130.23 g/mol |
| IUPAC name | 2,3,5-trideuterio-4,6-bis(trideuteriomethyl)aniline |
| InChIKey | CZZZABOKJQXEBO-XVGWXEQOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])N)[2H] |
Computed by PubChem (NCBI)