CAS 1020718-69-7 is the registry number for 2-Nitrobenzaldehyde-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
2,3,4,5-tetradeuterio-6-nitrobenzaldehyde (CAS 1020718-69-7) is a chemical compound with the molecular formula C7H5NO3 and a molecular weight of 155.14 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-nitrobenzaldehyde. InChIKey: CMWKITSNTDAEDT-RHQRLBAQSA-N.
| Molecular formula | C7H5NO3 |
|---|---|
| Molecular weight | 155.14 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-nitrobenzaldehyde |
| InChIKey | CMWKITSNTDAEDT-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C=O)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)