Products 1020718-69-7

CAS 1020718-69-7 is the registry number for 2-Nitrobenzaldehyde-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.

Structural formula: {0} (CAS {1})

2,3,4,5-tetradeuterio-6-nitrobenzaldehyde (CAS 1020718-69-7) is a chemical compound with the molecular formula C7H5NO3 and a molecular weight of 155.14 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-nitrobenzaldehyde. InChIKey: CMWKITSNTDAEDT-RHQRLBAQSA-N.

Identity
Molecular formulaC7H5NO3
Molecular weight155.14 g/mol
IUPAC name2,3,4,5-tetradeuterio-6-nitrobenzaldehyde
InChIKeyCMWKITSNTDAEDT-RHQRLBAQSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])C=O)[N+](=O)[O-])[2H])[2H]

Computed by PubChem (NCBI)