CAS 1020719-38-3 appears in our catalog under these names: 9-(2-(Diethylphosphonomethoxy)propyl-d6) Adenine, 9-[2-(Diethylphosphonomethoxy)propyl-d6] adenine. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
9-[1,1,2,3,3,3-hexadeuterio-2-(diethoxyphosphorylmethoxy)propyl]purin-6-amine (CAS 1020719-38-3) is a chemical compound with the molecular formula C13H22N5O4P and a molecular weight of 349.36 g/mol. IUPAC name: 9-[1,1,2,3,3,3-hexadeuterio-2-(diethoxyphosphorylmethoxy)propyl]purin-6-amine. InChIKey: GCOFRXOOFANVPB-QIMZAQQXSA-N.
| Molecular formula | C13H22N5O4P |
|---|---|
| Molecular weight | 349.36 g/mol |
| IUPAC name | 9-[1,1,2,3,3,3-hexadeuterio-2-(diethoxyphosphorylmethoxy)propyl]purin-6-amine |
| InChIKey | GCOFRXOOFANVPB-QIMZAQQXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])N1C=NC2=C(N=CN=C21)N)OCP(=O)(OCC)OCC |
Computed by PubChem (NCBI)