CAS 1020719-42-9 appears in our catalog under these names: Famciclovir-d4, Famciclovir–d4. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2500μg, 10mg, 50mg, 2.5 mg.
[2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)-3,3,4,4-tetradeuteriobutyl] acetate (CAS 1020719-42-9) is a chemical compound with the molecular formula C14H19N5O4 and a molecular weight of 325.36 g/mol. IUPAC name: [2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)-3,3,4,4-tetradeuteriobutyl] acetate. InChIKey: GGXKWVWZWMLJEH-KHORGVISSA-N.
| Molecular formula | C14H19N5O4 |
|---|---|
| Molecular weight | 325.36 g/mol |
| IUPAC name | [2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)-3,3,4,4-tetradeuteriobutyl] acetate |
| InChIKey | GGXKWVWZWMLJEH-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C(COC(=O)C)COC(=O)C)C([2H])([2H])N1C=NC2=CN=C(N=C21)N |
Computed by PubChem (NCBI)