CAS 1020719-64-5 appears in our catalog under these names: Isobutyramide-d6, 2-Methyl-d3-propionic-3,3,3-d3-amide. Offered by: TRC. Available pack sizes: 100mg, 50mg, 5mg.
3,3,3-trideuterio-2-(trideuteriomethyl)propanamide (CAS 1020719-64-5) is a chemical compound with the molecular formula C4H9NO and a molecular weight of 93.16 g/mol. IUPAC name: 3,3,3-trideuterio-2-(trideuteriomethyl)propanamide. InChIKey: WFKAJVHLWXSISD-WFGJKAKNSA-N.
| Molecular formula | C4H9NO |
|---|---|
| Molecular weight | 93.16 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-(trideuteriomethyl)propanamide |
| InChIKey | WFKAJVHLWXSISD-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)