CAS 102072-82-2 is the registry number for 6,7-Dichloroquinoxaline-5,8-dione. Offered by: Biosynth. Available pack sizes: 0,025mg, 0,05mg, 0,1mg, 0,25mg, 0,5mg.
6,7-dichloroquinoxaline-5,8-dione (CAS 102072-82-2) is a chemical compound with the molecular formula C8H2Cl2N2O2 and a molecular weight of 229.02 g/mol. IUPAC name: 6,7-dichloroquinoxaline-5,8-dione. InChIKey: SEYCJGXCYDOTGT-UHFFFAOYSA-N.
| Molecular formula | C8H2Cl2N2O2 |
|---|---|
| Molecular weight | 229.02 g/mol |
| IUPAC name | 6,7-dichloroquinoxaline-5,8-dione |
| InChIKey | SEYCJGXCYDOTGT-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)